C27H16Cl2N2O6 — CID 42639796
[(E)-2-(3,5-dichloro-4-pyridinyl)-1-(4-methoxy-8-nitrodibenzofuran-1-yl)ethenyl] benzoate (PubChem CID 42639796) has the molecular formula C27H16Cl2N2O6 and a molecular weight of 535.34 g/mol. Its IUPAC name is [(E)-2-(3,5-dichloro-4-pyridinyl)-1-(4-methoxy-8-nitrodibenzofuran-1-yl)ethenyl] benzoate.
| Compound Name | [(E)-2-(3,5-dichloro-4-pyridinyl)-1-(4-methoxy-8-nitrodibenzofuran-1-yl)ethenyl] benzoate |
|---|---|
| PubChem CID | 42639796 |
| Molecular Formula | C27H16Cl2N2O6 |
| Molecular Weight | 535.34 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | [(E)-2-(3,5-dichloro-4-pyridinyl)-1-(4-methoxy-8-nitrodibenzofuran-1-yl)ethenyl] benzoate |
| SMILES | COc1ccc(/C(=C\c2c(Cl)cncc2Cl)OC(=O)c2ccccc2)c2c1oc1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C27H16Cl2N2O6/c1-35-23-10-8-17(25-19-11-16(31(33)34)7-9-22(19)36-26(23)25)24(12-18-20(28)13-30-14-21(18)29)37-27(32)15-5-3-2-4-6-15/h2-14H,1H3/b24-12+ |
| InChIKey | IYFSQCUNWPZIKZ-WYMPLXKRSA-N |
| XLogP | 7.56 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.34 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|