C23H29O4S- — CID 123185460
4-[[3-(4-butan-2-ylphenoxy)cyclohexyl]methyl]benzenesulfonate (PubChem CID 123185460) has the molecular formula C23H29O4S- and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-[[3-(4-butan-2-ylphenoxy)cyclohexyl]methyl]benzenesulfonate.
| Compound Name | 4-[[3-(4-butan-2-ylphenoxy)cyclohexyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 123185460 |
| Molecular Formula | C23H29O4S- |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-[[3-(4-butan-2-ylphenoxy)cyclohexyl]methyl]benzenesulfonate |
| SMILES | CCC(C)c1ccc(OC2CCCC(Cc3ccc(S(=O)(=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C23H30O4S/c1-3-17(2)20-9-11-21(12-10-20)27-22-6-4-5-19(16-22)15-18-7-13-23(14-8-18)28(24,25)26/h7-14,17,19,22H,3-6,15-16H2,1-2H3,(H,24,25,26)/p-1 |
| InChIKey | DBAGWFSODGYEGN-UHFFFAOYSA-M |
| XLogP | 5.28 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|