C8H17NO5S — CID 123186070
2-(hydroxymethyl)-1-(2-sulfanyloxyethyl)piperidine-3,4,5-triol (PubChem CID 123186070) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-(2-sulfanyloxyethyl)piperidine-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-1-(2-sulfanyloxyethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 123186070 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(hydroxymethyl)-1-(2-sulfanyloxyethyl)piperidine-3,4,5-triol |
| SMILES | OCC1C(O)C(O)C(O)CN1CCOS |
| InChI | InChI=1S/C8H17NO5S/c10-4-5-7(12)8(13)6(11)3-9(5)1-2-14-15/h5-8,10-13,15H,1-4H2 |
| InChIKey | ODWFFLCBULFWRB-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|