C33H61F2N8O2+ — CID 123186167
2-amino-5-ethyl-7-fluoro-N-[5-fluoro-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]-4-methyl-10-(2-methylpentan-2-yl)-1,2,3,4,7,8,9,10-octahydro-1,5-diazecin-5-ium-3-carboxamide (PubChem CID 123186167) has the molecular formula C33H61F2N8O2+ and a molecular weight of 639.90 g/mol. Its IUPAC name is 2-amino-5-ethyl-7-fluoro-N-[5-fluoro-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]-4-methyl-10-(2-methylpentan-2-yl)-1,2,3,4,7,8,9,10-octahydro-1,5-diazecin-5-ium-3-carboxamide.
| Compound Name | 2-amino-5-ethyl-7-fluoro-N-[5-fluoro-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]-4-methyl-10-(2-methylpentan-2-yl)-1,2,3,4,7,8,9,10-octahydro-1,5-diazecin-5-ium-3-carboxamide |
|---|---|
| PubChem CID | 123186167 |
| Molecular Formula | C33H61F2N8O2+ |
| Molecular Weight | 639.90 g/mol |
| Exact Mass | 639.49 |
| IUPAC Name | 2-amino-5-ethyl-7-fluoro-N-[5-fluoro-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]piperidin-3-yl]-4-methyl-10-(2-methylpentan-2-yl)-1,2,3,4,7,8,9,10-octahydro-1,5-diazecin-5-ium-3-carboxamide |
| SMILES | CCCC(C)(C)C1CCC(F)/C=[N+](/CC)C(C)C(C(=O)NC2CNCC(F)C2N2CCC(C(=O)N3CCNCC3)CC2)C(N)N1 |
| InChI | InChI=1S/C33H60F2N8O2/c1-6-12-33(4,5)27-9-8-24(34)21-41(7-2)22(3)28(30(36)40-27)31(44)39-26-20-38-19-25(35)29(26)42-15-10-23(11-16-42)32(45)43-17-13-37-14-18-43/h21-30,37-38,40H,6-20,36H2,1-5H3/p+1/b41-21- |
| InChIKey | BMYAMWFLAGPZTH-WBFBQHAKSA-O |
| XLogP | 1.23 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.90 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|