C31H57FN8O2 — CID 123708999
3,3-diamino-2-(4-ethyl-8-fluoro-4-pentyl-2,3,5,6,7,8-hexahydroazonin-2-yl)-N-[4-(8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide (PubChem CID 123708999) has the molecular formula C31H57FN8O2 and a molecular weight of 592.85 g/mol. Its IUPAC name is 3,3-diamino-2-(4-ethyl-8-fluoro-4-pentyl-2,3,5,6,7,8-hexahydroazonin-2-yl)-N-[4-(8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-ethyl-8-fluoro-4-pentyl-2,3,5,6,7,8-hexahydroazonin-2-yl)-N-[4-(8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123708999 |
| Molecular Formula | C31H57FN8O2 |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.46 |
| IUPAC Name | 3,3-diamino-2-(4-ethyl-8-fluoro-4-pentyl-2,3,5,6,7,8-hexahydroazonin-2-yl)-N-[4-(8-methyl-9-oxo-1,3,4,6,7,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCCCCC1(CC)CCCC(F)/C=N\C(C(C(=O)NC2CNCCC2N2CCN3CCN(C)C(=O)C3C2)C(N)N)C1 |
| InChI | InChI=1S/C31H57FN8O2/c1-4-6-7-11-31(5-2)12-8-9-22(32)19-36-23(18-31)27(28(33)34)29(41)37-24-20-35-13-10-25(24)40-17-16-39-15-14-38(3)30(42)26(39)21-40/h19,22-28,35H,4-18,20-21,33-34H2,1-3H3,(H,37,41)/b36-19- |
| InChIKey | AEDULBSZVBIFDP-WBIBEUCMSA-N |
| XLogP | 1.48 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|