C12H25N3 — CID 123186699
3-N,3-N-bis(ethenyl)-2,5-dimethylhexane-2,3,5-triamine (PubChem CID 123186699) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-N,3-N-bis(ethenyl)-2,5-dimethylhexane-2,3,5-triamine.
| Compound Name | 3-N,3-N-bis(ethenyl)-2,5-dimethylhexane-2,3,5-triamine |
|---|---|
| PubChem CID | 123186699 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 3-N,3-N-bis(ethenyl)-2,5-dimethylhexane-2,3,5-triamine |
| SMILES | C=CN(C=C)C(CC(C)(C)N)C(C)(C)N |
| InChI | InChI=1S/C12H25N3/c1-7-15(8-2)10(12(5,6)14)9-11(3,4)13/h7-8,10H,1-2,9,13-14H2,3-6H3 |
| InChIKey | LNDIJYAHGKUSPQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |