C11H13ClN4O4 — CID 123187173
1-(2-chloro-5-nitropyrimidin-4-yl)-2-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxylic acid (PubChem CID 123187173) has the molecular formula C11H13ClN4O4 and a molecular weight of 305.73 g/mol. Its IUPAC name is 1-(2-chloro-5-nitropyrimidin-4-yl)-2-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-chloro-5-nitropyrimidin-4-yl)-2-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123187173 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-(2-chloro-5-nitropyrimidin-4-yl)-2-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)O)CCCN1c1nc(Cl)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13ClN4O4/c1-2-11(9(17)18)4-3-5-15(11)8-7(16(19)20)6-13-10(12)14-8/h6H,2-5H2,1H3,(H,17,18)/i1D3,2D2 |
| InChIKey | DHRYCYOLKLBHPB-ZBJDZAJPSA-N |
| XLogP | 1.87 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|