C12H14ClN3O — CID 58405752
(6aS)-2-chloro-6a-(1,1,2,2,2-pentadeuterioethyl)-5,7,8,9-tetrahydropyrimido[4,5-e]indolizin-6-one (PubChem CID 58405752) has the molecular formula C12H14ClN3O and a molecular weight of 256.75 g/mol. Its IUPAC name is (6aS)-2-chloro-6a-(1,1,2,2,2-pentadeuterioethyl)-5,7,8,9-tetrahydropyrimido[4,5-e]indolizin-6-one.
| Compound Name | (6aS)-2-chloro-6a-(1,1,2,2,2-pentadeuterioethyl)-5,7,8,9-tetrahydropyrimido[4,5-e]indolizin-6-one |
|---|---|
| PubChem CID | 58405752 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (6aS)-2-chloro-6a-(1,1,2,2,2-pentadeuterioethyl)-5,7,8,9-tetrahydropyrimido[4,5-e]indolizin-6-one |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@]12CCCN1c1nc(Cl)ncc1CC2=O |
| InChI | InChI=1S/C12H14ClN3O/c1-2-12-4-3-5-16(12)10-8(6-9(12)17)7-14-11(13)15-10/h7H,2-6H2,1H3/t12-/m0/s1/i1D3,2D2 |
| InChIKey | JNRCXDBRMIIWMA-ZDENUIFTSA-N |
| XLogP | 2.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |