C20H19ClFN3O3S2 — CID 123187588
3-[3-chloro-5-[3-fluoro-5-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 123187588) has the molecular formula C20H19ClFN3O3S2 and a molecular weight of 467.98 g/mol. Its IUPAC name is 3-[3-chloro-5-[3-fluoro-5-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | 3-[3-chloro-5-[3-fluoro-5-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 123187588 |
| Molecular Formula | C20H19ClFN3O3S2 |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-[3-chloro-5-[3-fluoro-5-(1,3-oxazol-5-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | CC1(c2sc(-c3cc(F)cc(-c4cnco4)c3)cc2Cl)CS(=O)(=O)C(C)(C)C(N)=N1 |
| InChI | InChI=1S/C20H19ClFN3O3S2/c1-19(2)18(23)25-20(3,9-30(19,26)27)17-14(21)7-16(29-17)12-4-11(5-13(22)6-12)15-8-24-10-28-15/h4-8,10H,9H2,1-3H3,(H2,23,25) |
| InChIKey | OMNZSVLJRZCPHO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |