C6H6FO2S- — CID 123189194
4-fluorocyclohexa-1,3-diene-1-sulfinate (PubChem CID 123189194) has the molecular formula C6H6FO2S- and a molecular weight of 161.18 g/mol. Its IUPAC name is 4-fluorocyclohexa-1,3-diene-1-sulfinate.
| Compound Name | 4-fluorocyclohexa-1,3-diene-1-sulfinate |
|---|---|
| PubChem CID | 123189194 |
| Molecular Formula | C6H6FO2S- |
| Molecular Weight | 161.18 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 4-fluorocyclohexa-1,3-diene-1-sulfinate |
| SMILES | O=S([O-])C1=CC=C(F)CC1 |
| InChI | InChI=1S/C6H7FO2S/c7-5-1-3-6(4-2-5)10(8)9/h1,3H,2,4H2,(H,8,9)/p-1 |
| InChIKey | JGNATJNPPGEKHT-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|