C15H23BrN4O2 — CID 123189410
6-bromo-8-(3-ethoxypropyl)-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol (PubChem CID 123189410) has the molecular formula C15H23BrN4O2 and a molecular weight of 371.28 g/mol. Its IUPAC name is 6-bromo-8-(3-ethoxypropyl)-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol.
| Compound Name | 6-bromo-8-(3-ethoxypropyl)-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 123189410 |
| Molecular Formula | C15H23BrN4O2 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-bromo-8-(3-ethoxypropyl)-2-(ethylamino)-4-methyl-7H-pyrido[2,3-d]pyrimidin-7-ol |
| SMILES | CCNc1nc(C)c2c(n1)N(CCCOCC)C(O)C(Br)=C2 |
| InChI | InChI=1S/C15H23BrN4O2/c1-4-17-15-18-10(3)11-9-12(16)14(21)20(13(11)19-15)7-6-8-22-5-2/h9,14,21H,4-8H2,1-3H3,(H,17,18,19) |
| InChIKey | UCEOHHZMKPFNJC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|