C24H24FNO4 — CID 123190455
(2R,3R)-8-(4-fluorophenyl)-2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)oct-7-yne-1,4-dione (PubChem CID 123190455) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is (2R,3R)-8-(4-fluorophenyl)-2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)oct-7-yne-1,4-dione.
| Compound Name | (2R,3R)-8-(4-fluorophenyl)-2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)oct-7-yne-1,4-dione |
|---|---|
| PubChem CID | 123190455 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (2R,3R)-8-(4-fluorophenyl)-2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)oct-7-yne-1,4-dione |
| SMILES | O=C(CCC#Cc1ccc(F)cc1)[C@H](O)[C@@H](O)C(=O)N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C24H24FNO4/c25-19-14-12-17(13-15-19)7-4-5-11-21(27)22(28)23(29)24(30)26-16-6-10-20(26)18-8-2-1-3-9-18/h1-3,8-9,12-15,20,22-23,28-29H,5-6,10-11,16H2/t20?,22-,23+/m0/s1 |
| InChIKey | RKXATTKUZVONAJ-XGELLPRESA-N |
| XLogP | 2.61 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|