C18H23NO4 — CID 135009183
(3S,4S)-1-benzyl-3-[(S)-cyclohexyl(hydroxy)methyl]-4-hydroxypyrrolidine-2,5-dione (PubChem CID 135009183) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-3-[(S)-cyclohexyl(hydroxy)methyl]-4-hydroxypyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-1-benzyl-3-[(S)-cyclohexyl(hydroxy)methyl]-4-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135009183 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3S,4S)-1-benzyl-3-[(S)-cyclohexyl(hydroxy)methyl]-4-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1[C@@H]([C@@H](O)C2CCCCC2)[C@H](O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c20-15(13-9-5-2-6-10-13)14-16(21)18(23)19(17(14)22)11-12-7-3-1-4-8-12/h1,3-4,7-8,13-16,20-21H,2,5-6,9-11H2/t14-,15-,16-/m0/s1 |
| InChIKey | NVEPWTMILIIQLB-JYJNAYRXSA-N |
| XLogP | 1.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|