C16H26N6O2 — CID 123192941
tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate (PubChem CID 123192941) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123192941 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | tert-butyl 3-[(6-amino-5-propanimidoylpyrimidin-4-yl)amino]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\CC)c1c(N)ncnc1NC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26N6O2/c1-5-11(17)12-13(18)19-9-20-14(12)21-10-6-7-22(8-10)15(23)24-16(2,3)4/h9-10,17H,5-8H2,1-4H3,(H3,18,19,20,21)/b17-11+ |
| InChIKey | YKBKALMLTUGNNP-GZTJUZNOSA-N |
| XLogP | 2.26 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|