C15H23FN4O2 — CID 133420484
tert-butyl N-[(3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 133420484) has the molecular formula C15H23FN4O2 and a molecular weight of 310.37 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 133420484 |
| Molecular Formula | C15H23FN4O2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | tert-butyl N-[(3R)-1-(6-ethyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CCc1ncnc(N2CC[C@@H](NC(=O)OC(C)(C)C)C2)c1F |
| InChI | InChI=1S/C15H23FN4O2/c1-5-11-12(16)13(18-9-17-11)20-7-6-10(8-20)19-14(21)22-15(2,3)4/h9-10H,5-8H2,1-4H3,(H,19,21)/t10-/m1/s1 |
| InChIKey | QZBOIBTZAZHZRC-SNVBAGLBSA-N |
| XLogP | 2.28 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |