C14H24NO5P — CID 123193541
[[2-ethyl-6-hydroxy-4-(hydroxymethyl)phenyl]methyl-propylamino]methylphosphonic acid (PubChem CID 123193541) has the molecular formula C14H24NO5P and a molecular weight of 317.32 g/mol. Its IUPAC name is [[2-ethyl-6-hydroxy-4-(hydroxymethyl)phenyl]methyl-propylamino]methylphosphonic acid.
| Compound Name | [[2-ethyl-6-hydroxy-4-(hydroxymethyl)phenyl]methyl-propylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 123193541 |
| Molecular Formula | C14H24NO5P |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [[2-ethyl-6-hydroxy-4-(hydroxymethyl)phenyl]methyl-propylamino]methylphosphonic acid |
| SMILES | CCCN(Cc1c(O)cc(CO)cc1CC)CP(=O)(O)O |
| InChI | InChI=1S/C14H24NO5P/c1-3-5-15(10-21(18,19)20)8-13-12(4-2)6-11(9-16)7-14(13)17/h6-7,16-17H,3-5,8-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | JSYFETHXQGEAHD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|