C27H36N4O3 — CID 123194469
4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxy-N-methylcyclohex-3-ene-1-carboxamide (PubChem CID 123194469) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxy-N-methylcyclohex-3-ene-1-carboxamide.
| Compound Name | 4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxy-N-methylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 123194469 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]-N-methoxy-N-methylcyclohex-3-ene-1-carboxamide |
| SMILES | CCc1cnc(N2CCC(COc3ccc(C4=CCC(C(=O)N(C)OC)CC4)cc3)CC2)nc1 |
| InChI | InChI=1S/C27H36N4O3/c1-4-20-17-28-27(29-18-20)31-15-13-21(14-16-31)19-34-25-11-9-23(10-12-25)22-5-7-24(8-6-22)26(32)30(2)33-3/h5,9-12,17-18,21,24H,4,6-8,13-16,19H2,1-3H3 |
| InChIKey | WTOWSGCZEQOFEG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|