C31H45N4O2+ — CID 144954390
[[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-hydroxymethylidene]-methyl-pentylazanium (PubChem CID 144954390) has the molecular formula C31H45N4O2+ and a molecular weight of 505.73 g/mol. Its IUPAC name is [[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-hydroxymethylidene]-methyl-pentylazanium.
| Compound Name | [[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-hydroxymethylidene]-methyl-pentylazanium |
|---|---|
| PubChem CID | 144954390 |
| Molecular Formula | C31H45N4O2+ |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.35 |
| IUPAC Name | [[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]phenyl]cyclohex-3-en-1-yl]-hydroxymethylidene]-methyl-pentylazanium |
| SMILES | CCCCC/[N+](C)=C(\O)C1CC=C(c2ccc(OCC3CCN(c4ncc(CC)cn4)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H44N4O2/c1-4-6-7-18-34(3)30(36)28-10-8-26(9-11-28)27-12-14-29(15-13-27)37-23-25-16-19-35(20-17-25)31-32-21-24(5-2)22-33-31/h8,12-15,21-22,25,28H,4-7,9-11,16-20,23H2,1-3H3/p+1 |
| InChIKey | AXBFHSCKEVLRKA-UHFFFAOYSA-O |
| XLogP | 6.31 |
| TPSA | 61.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|