C23H21F5N3O4+ — CID 123196105
4-[1-[[3-(difluoromethyl)-1,1-dimethyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-1-ium-4-carbonyl]amino]ethyl]benzoic acid (PubChem CID 123196105) has the molecular formula C23H21F5N3O4+ and a molecular weight of 498.43 g/mol. Its IUPAC name is 4-[1-[[3-(difluoromethyl)-1,1-dimethyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-1-ium-4-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[3-(difluoromethyl)-1,1-dimethyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-1-ium-4-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 123196105 |
| Molecular Formula | C23H21F5N3O4+ |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 4-[1-[[3-(difluoromethyl)-1,1-dimethyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-1-ium-4-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)C1=C(Oc2cccc(C(F)(F)F)c2)[N+](C)(C)N=C1C(F)F)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H20F5N3O4/c1-12(13-7-9-14(10-8-13)22(33)34)29-20(32)17-18(19(24)25)30-31(2,3)21(17)35-16-6-4-5-15(11-16)23(26,27)28/h4-12,19H,1-3H3,(H-,29,32,33,34)/p+1 |
| InChIKey | GGRHFVPRVXAAGH-UHFFFAOYSA-O |
| XLogP | 4.58 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|