About (2,5-dihydroxypyrrol-1-yl) carbonofluoridate
(2,5-dihydroxypyrrol-1-yl) carbonofluoridate (PubChem CID 123197367) has the molecular formula C5H4FNO4
and a molecular weight of 161.09 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) carbonofluoridate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) carbonofluoridate |
| PubChem CID | 123197367 |
| Molecular Formula | C5H4FNO4 |
| Molecular Weight | 161.09 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) carbonofluoridate |
| SMILES | O=C(F)On1c(O)ccc1O |
| InChI | InChI=1S/C5H4FNO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-2,8-9H |
| InChIKey | NJYRZDRMDKUCJO-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.09 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) carbonofluoridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) carbonofluoridate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) carbonofluoridate (CID 123197367) is (2,5-dihydroxypyrrol-1-yl) carbonofluoridate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) carbonofluoridate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) carbonofluoridate is O=C(F)On1c(O)ccc1O.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) carbonofluoridate?
The InChIKey is NJYRZDRMDKUCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4FNO4/c6-5(10)11-7-3(8)1-2-4(7)9/h1-2,8-9H.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) carbonofluoridate?
(2,5-dihydroxypyrrol-1-yl) carbonofluoridate has a molecular weight of 161.09 g/mol, XLogP of 0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) carbonofluoridate is sourced from PubChem (CID 123197367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).