C10H17N — CID 123197604
2,6-dimethylocta-1,6-dien-3-imine (PubChem CID 123197604) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,6-dimethylocta-1,6-dien-3-imine.
| Compound Name | 2,6-dimethylocta-1,6-dien-3-imine |
|---|---|
| PubChem CID | 123197604 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,6-dimethylocta-1,6-dien-3-imine |
| SMILES | [H]/N=C(\CCC(C)=CC)C(=C)C |
| InChI | InChI=1S/C10H17N/c1-5-9(4)6-7-10(11)8(2)3/h5,11H,2,6-7H2,1,3-4H3/b9-5?,11-10+ |
| InChIKey | CSIVVNVWSCMUGJ-NTKHTPNBSA-N |
| XLogP | 3.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|