About [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate
[1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate (PubChem CID 123199608) has the molecular formula C22H28BrN3O2
and a molecular weight of 446.39 g/mol. Its IUPAC name is [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate |
| PubChem CID | 123199608 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2nc3c([nH]2)CCc2cc(Br)ccc2-3)CCCCC1 |
| InChI | InChI=1S/C22H28BrN3O2/c1-21(2,3)26-20(27)28-22(11-5-4-6-12-22)19-24-17-10-7-14-13-15(23)8-9-16(14)18(17)25-19/h8-9,13H,4-7,10-12H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | NDDMVKMLOFMMBB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate?
The IUPAC name of [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate (CID 123199608) is [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate.
What is the SMILES notation for [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate?
The canonical SMILES for [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1(c2nc3c([nH]2)CCc2cc(Br)ccc2-3)CCCCC1.
What is the InChIKey of [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate?
The InChIKey is NDDMVKMLOFMMBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28BrN3O2/c1-21(2,3)26-20(27)28-22(11-5-4-6-12-22)19-24-17-10-7-14-13-15(23)8-9-16(14)18(17)25-19/h8-9,13H,4-7,10-12H2,1-3H3,(H,24,25)(H,26,27).
What are the key properties of [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate?
[1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate has a molecular weight of 446.39 g/mol, XLogP of 5.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(7-bromo-4,5-dihydro-3H-benzo[e]benzimidazol-2-yl)cyclohexyl] N-tert-butylcarbamate is sourced from PubChem (CID 123199608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).