C19H21F3N6O3S — CID 123201617
5-(6-morpholin-4-yl-11,11-dioxo-11λ6-thia-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 123201617) has the molecular formula C19H21F3N6O3S and a molecular weight of 470.48 g/mol. Its IUPAC name is 5-(6-morpholin-4-yl-11,11-dioxo-11λ6-thia-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(6-morpholin-4-yl-11,11-dioxo-11λ6-thia-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 123201617 |
| Molecular Formula | C19H21F3N6O3S |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 5-(6-morpholin-4-yl-11,11-dioxo-11λ6-thia-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)c3c(n2)N2CCS(=O)(=O)CC2C3)cn1 |
| InChI | InChI=1S/C19H21F3N6O3S/c20-19(21,22)14-8-15(23)24-9-13(14)16-25-17(27-1-4-31-5-2-27)12-7-11-10-32(29,30)6-3-28(11)18(12)26-16/h8-9,11H,1-7,10H2,(H2,23,24) |
| InChIKey | YVTSPCJMDMNDQZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |