C19H21F3N6O2 — CID 118000036
5-[(9S)-4-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-6-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 118000036) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 5-[(9S)-4-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-6-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[(9S)-4-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-6-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 118000036 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 5-[(9S)-4-morpholin-4-yl-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-6-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)c(-c2nc(N3CCOCC3)nc3c2C[C@H]2COCCN32)cn1 |
| InChI | InChI=1S/C19H21F3N6O2/c20-19(21,22)14-8-15(23)24-9-13(14)16-12-7-11-10-30-6-3-28(11)17(12)26-18(25-16)27-1-4-29-5-2-27/h8-9,11H,1-7,10H2,(H2,23,24)/t11-/m0/s1 |
| InChIKey | GLPWETMUURNSHR-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |