C15H19N — CID 123203843
2-(3H-inden-1-ylmethyl)piperidine (PubChem CID 123203843) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(3H-inden-1-ylmethyl)piperidine.
| Compound Name | 2-(3H-inden-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 123203843 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-(3H-inden-1-ylmethyl)piperidine |
| SMILES | C1=C(CC2CCCCN2)c2ccccc2C1 |
| InChI | InChI=1S/C15H19N/c1-2-7-15-12(5-1)8-9-13(15)11-14-6-3-4-10-16-14/h1-2,5,7,9,14,16H,3-4,6,8,10-11H2 |
| InChIKey | HJVZTSFVQYTXFZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |