C15H18N2O2 — CID 115053966
2-[5-(piperidin-2-ylmethyl)-1,2-oxazol-4-yl]phenol (PubChem CID 115053966) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[5-(piperidin-2-ylmethyl)-1,2-oxazol-4-yl]phenol.
| Compound Name | 2-[5-(piperidin-2-ylmethyl)-1,2-oxazol-4-yl]phenol |
|---|---|
| PubChem CID | 115053966 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-[5-(piperidin-2-ylmethyl)-1,2-oxazol-4-yl]phenol |
| SMILES | Oc1ccccc1-c1cnoc1CC1CCCCN1 |
| InChI | InChI=1S/C15H18N2O2/c18-14-7-2-1-6-12(14)13-10-17-19-15(13)9-11-5-3-4-8-16-11/h1-2,6-7,10-11,16,18H,3-5,8-9H2 |
| InChIKey | NQSQMISMUIQOAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |