C34H27F2N5O2 — CID 123203874
N-[3-carbazol-9-yl-2,4-difluoro-5-[2-hydroxy-N-(methyliminomethyl)anilino]phenyl]-N-[2-(methylamino)phenyl]formamide (PubChem CID 123203874) has the molecular formula C34H27F2N5O2 and a molecular weight of 575.62 g/mol. Its IUPAC name is N-[3-carbazol-9-yl-2,4-difluoro-5-[2-hydroxy-N-(methyliminomethyl)anilino]phenyl]-N-[2-(methylamino)phenyl]formamide.
| Compound Name | N-[3-carbazol-9-yl-2,4-difluoro-5-[2-hydroxy-N-(methyliminomethyl)anilino]phenyl]-N-[2-(methylamino)phenyl]formamide |
|---|---|
| PubChem CID | 123203874 |
| Molecular Formula | C34H27F2N5O2 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | N-[3-carbazol-9-yl-2,4-difluoro-5-[2-hydroxy-N-(methyliminomethyl)anilino]phenyl]-N-[2-(methylamino)phenyl]formamide |
| SMILES | C/N=C/N(c1ccccc1O)c1cc(N(C=O)c2ccccc2NC)c(F)c(-n2c3ccccc3c3ccccc32)c1F |
| InChI | InChI=1S/C34H27F2N5O2/c1-37-20-39(28-17-9-10-18-31(28)43)29-19-30(40(21-42)27-16-8-5-13-24(27)38-2)33(36)34(32(29)35)41-25-14-6-3-11-22(25)23-12-4-7-15-26(23)41/h3-21,38,43H,1-2H3/b37-20+ |
| InChIKey | BBCVRDMMOYVAEI-HASSKWOGSA-N |
| XLogP | 7.90 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|