C42H38F2N4O2 — CID 140633478
2-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-fluoro-6-(2-phenylanilino)phenol (PubChem CID 140633478) has the molecular formula C42H38F2N4O2 and a molecular weight of 668.79 g/mol. Its IUPAC name is 2-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-fluoro-6-(2-phenylanilino)phenol.
| Compound Name | 2-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-fluoro-6-(2-phenylanilino)phenol |
|---|---|
| PubChem CID | 140633478 |
| Molecular Formula | C42H38F2N4O2 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 2-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-fluoro-6-(2-phenylanilino)phenol |
| SMILES | CN(CCN(C)Cc1cc(F)cc(-n2c3ccccc3c3ccccc32)c1O)Cc1cc(F)cc(Nc2ccccc2-c2ccccc2)c1O |
| InChI | InChI=1S/C42H38F2N4O2/c1-46(26-29-22-31(43)24-37(41(29)49)45-36-17-9-6-14-33(36)28-12-4-3-5-13-28)20-21-47(2)27-30-23-32(44)25-40(42(30)50)48-38-18-10-7-15-34(38)35-16-8-11-19-39(35)48/h3-19,22-25,45,49-50H,20-21,26-27H2,1-2H3 |
| InChIKey | APIMQTJWSHDMHN-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|