C17H21BrN2 — CID 123205399
N-[(7-bromo-3-methyl-9a,9b-dihydro-3H-benzo[g]indol-2-yl)methyl]propan-1-amine (PubChem CID 123205399) has the molecular formula C17H21BrN2 and a molecular weight of 333.27 g/mol. Its IUPAC name is N-[(7-bromo-3-methyl-9a,9b-dihydro-3H-benzo[g]indol-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(7-bromo-3-methyl-9a,9b-dihydro-3H-benzo[g]indol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 123205399 |
| Molecular Formula | C17H21BrN2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | N-[(7-bromo-3-methyl-9a,9b-dihydro-3H-benzo[g]indol-2-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1=NC2C(=CC=C3C=C(Br)C=CC32)C1C |
| InChI | InChI=1S/C17H21BrN2/c1-3-8-19-10-16-11(2)14-6-4-12-9-13(18)5-7-15(12)17(14)20-16/h4-7,9,11,15,17,19H,3,8,10H2,1-2H3 |
| InChIKey | KAXZWKYLCQEWDL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|