C54H49NSi2 — CID 123205402
9,9-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]-N-(4-triphenylsilylphenyl)fluoren-2-amine (PubChem CID 123205402) has the molecular formula C54H49NSi2 and a molecular weight of 768.17 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]-N-(4-triphenylsilylphenyl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]-N-(4-triphenylsilylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 123205402 |
| Molecular Formula | C54H49NSi2 |
| Molecular Weight | 768.17 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | 9,9-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]-N-(4-triphenylsilylphenyl)fluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc([Si](C)(C)C)cc4)cc3)c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C54H49NSi2/c1-54(2)52-24-16-15-23-50(52)51-38-33-44(39-53(51)54)55(42-29-25-40(26-30-42)41-27-34-45(35-28-41)56(3,4)5)43-31-36-49(37-32-43)57(46-17-9-6-10-18-46,47-19-11-7-12-20-47)48-21-13-8-14-22-48/h6-39H,1-5H3 |
| InChIKey | KBSUMHPYHHUGKU-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.17 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|