C47H43NSi — CID 90306203
N-(9,9-dimethylfluoren-2-yl)-15,15-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-3-amine (PubChem CID 90306203) has the molecular formula C47H43NSi and a molecular weight of 649.95 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-15,15-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-3-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-15,15-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-3-amine |
|---|---|
| PubChem CID | 90306203 |
| Molecular Formula | C47H43NSi |
| Molecular Weight | 649.95 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-15,15-dimethyl-N-[4-(4-trimethylsilylphenyl)phenyl]tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaen-3-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4ccc([Si](C)(C)C)cc4)cc3)c3cc4c5c(ccc6cccc(c65)C4(C)C)c3)cc21 |
| InChI | InChI=1S/C47H43NSi/c1-46(2)40-13-9-8-12-38(40)39-26-23-35(28-42(39)46)48(34-21-17-30(18-22-34)31-19-24-37(25-20-31)49(5,6)7)36-27-33-16-15-32-11-10-14-41-44(32)45(33)43(29-36)47(41,3)4/h8-29H,1-7H3 |
| InChIKey | SCQXDGNSSVGLBH-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.95 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|