C53H46N2Si — CID 90306200
N-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(9,9-dimethyl-7-trimethylsilylfluoren-2-yl)-9-phenylcarbazol-3-amine (PubChem CID 90306200) has the molecular formula C53H46N2Si and a molecular weight of 739.05 g/mol. Its IUPAC name is N-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(9,9-dimethyl-7-trimethylsilylfluoren-2-yl)-9-phenylcarbazol-3-amine.
| Compound Name | N-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(9,9-dimethyl-7-trimethylsilylfluoren-2-yl)-9-phenylcarbazol-3-amine |
|---|---|
| PubChem CID | 90306200 |
| Molecular Formula | C53H46N2Si |
| Molecular Weight | 739.05 g/mol |
| Exact Mass | 738.34 |
| IUPAC Name | N-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)-N-(9,9-dimethyl-7-trimethylsilylfluoren-2-yl)-9-phenylcarbazol-3-amine |
| SMILES | CC1(C)c2cc(N(c3cc4c5c(ccc6cccc(c65)C4(C)C)c3)c3ccc4c(c3)c3ccccc3n4-c3ccccc3)ccc2-c2ccc([Si](C)(C)C)cc21 |
| InChI | InChI=1S/C53H46N2Si/c1-52(2)44-18-13-14-33-20-21-34-28-38(31-47(52)51(34)50(33)44)54(37-22-25-40-41-26-24-39(56(5,6)7)32-46(41)53(3,4)45(40)30-37)36-23-27-49-43(29-36)42-17-11-12-19-48(42)55(49)35-15-9-8-10-16-35/h8-32H,1-7H3 |
| InChIKey | GTFQYCYCXAJBDP-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.05 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|