C45H34N2 — CID 90307925
4-[N-(9,9-dimethylfluoren-2-yl)-4-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)anilino]benzonitrile (PubChem CID 90307925) has the molecular formula C45H34N2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 4-[N-(9,9-dimethylfluoren-2-yl)-4-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)anilino]benzonitrile.
| Compound Name | 4-[N-(9,9-dimethylfluoren-2-yl)-4-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)anilino]benzonitrile |
|---|---|
| PubChem CID | 90307925 |
| Molecular Formula | C45H34N2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 4-[N-(9,9-dimethylfluoren-2-yl)-4-(15,15-dimethyl-3-tetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8(13),9,11-heptaenyl)anilino]benzonitrile |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(C#N)cc3)c3ccc(-c4cc5c6c(ccc7cccc(c76)C5(C)C)c4)cc3)cc21 |
| InChI | InChI=1S/C45H34N2/c1-44(2)38-10-6-5-9-36(38)37-23-22-35(26-40(37)44)47(33-18-12-28(27-46)13-19-33)34-20-16-29(17-21-34)32-24-31-15-14-30-8-7-11-39-42(30)43(31)41(25-32)45(39,3)4/h5-26H,1-4H3 |
| InChIKey | JNRIZGKNSYLIQV-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|