C49H50N2Si2 — CID 140774313
11,11-dimethyl-2-N,8-N-diphenyl-2-N,8-N-bis(4-trimethylsilylphenyl)benzo[b]fluorene-2,8-diamine (PubChem CID 140774313) has the molecular formula C49H50N2Si2 and a molecular weight of 723.13 g/mol. Its IUPAC name is 11,11-dimethyl-2-N,8-N-diphenyl-2-N,8-N-bis(4-trimethylsilylphenyl)benzo[b]fluorene-2,8-diamine.
| Compound Name | 11,11-dimethyl-2-N,8-N-diphenyl-2-N,8-N-bis(4-trimethylsilylphenyl)benzo[b]fluorene-2,8-diamine |
|---|---|
| PubChem CID | 140774313 |
| Molecular Formula | C49H50N2Si2 |
| Molecular Weight | 723.13 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | 11,11-dimethyl-2-N,8-N-diphenyl-2-N,8-N-bis(4-trimethylsilylphenyl)benzo[b]fluorene-2,8-diamine |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccc([Si](C)(C)C)cc3)ccc2-c2cc3ccc(N(c4ccccc4)c4ccc([Si](C)(C)C)cc4)cc3cc21 |
| InChI | InChI=1S/C49H50N2Si2/c1-49(2)47-33-36-31-41(50(37-15-11-9-12-16-37)39-21-26-43(27-22-39)52(3,4)5)20-19-35(36)32-46(47)45-30-25-42(34-48(45)49)51(38-17-13-10-14-18-38)40-23-28-44(29-24-40)53(6,7)8/h9-34H,1-8H3 |
| InChIKey | RCFHJAYTLHLDRS-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.13 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|