C43H32I2N2S2 — CID 126615908
[4-(N-[2-(N-(4-iodosulfanylphenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]anilino)phenyl] thiohypoiodite (PubChem CID 126615908) has the molecular formula C43H32I2N2S2 and a molecular weight of 894.69 g/mol. Its IUPAC name is [4-(N-[2-(N-(4-iodosulfanylphenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]anilino)phenyl] thiohypoiodite.
| Compound Name | [4-(N-[2-(N-(4-iodosulfanylphenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]anilino)phenyl] thiohypoiodite |
|---|---|
| PubChem CID | 126615908 |
| Molecular Formula | C43H32I2N2S2 |
| Molecular Weight | 894.69 g/mol |
| Exact Mass | 894.01 |
| IUPAC Name | [4-(N-[2-(N-(4-iodosulfanylphenyl)anilino)-11,11-dimethylbenzo[b]fluoren-8-yl]anilino)phenyl] thiohypoiodite |
| SMILES | CC1(C)c2cc(N(c3ccccc3)c3ccc(SI)cc3)ccc2-c2cc3ccc(N(c4ccccc4)c4ccc(SI)cc4)cc3cc21 |
| InChI | InChI=1S/C43H32I2N2S2/c1-43(2)41-27-30-25-35(46(31-9-5-3-6-10-31)33-15-20-37(48-44)21-16-33)14-13-29(30)26-40(41)39-24-19-36(28-42(39)43)47(32-11-7-4-8-12-32)34-17-22-38(49-45)23-18-34/h3-28H,1-2H3 |
| InChIKey | CHWIBNCIUTVACO-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.69 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|