C63H56N2Si2 — CID 123150757
2-N,7-N-dinaphthalen-2-yl-9,9-diphenyl-2-N,7-N-bis(4-trimethylsilylphenyl)fluorene-2,7-diamine (PubChem CID 123150757) has the molecular formula C63H56N2Si2 and a molecular weight of 897.33 g/mol. Its IUPAC name is 2-N,7-N-dinaphthalen-2-yl-9,9-diphenyl-2-N,7-N-bis(4-trimethylsilylphenyl)fluorene-2,7-diamine.
| Compound Name | 2-N,7-N-dinaphthalen-2-yl-9,9-diphenyl-2-N,7-N-bis(4-trimethylsilylphenyl)fluorene-2,7-diamine |
|---|---|
| PubChem CID | 123150757 |
| Molecular Formula | C63H56N2Si2 |
| Molecular Weight | 897.33 g/mol |
| Exact Mass | 896.40 |
| IUPAC Name | 2-N,7-N-dinaphthalen-2-yl-9,9-diphenyl-2-N,7-N-bis(4-trimethylsilylphenyl)fluorene-2,7-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(N(c4ccc([Si](C)(C)C)cc4)c4ccc5ccccc5c4)ccc2-3)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C63H56N2Si2/c1-66(2,3)57-35-29-51(30-36-57)64(53-27-25-45-17-13-15-19-47(45)41-53)55-33-39-59-60-40-34-56(44-62(60)63(61(59)43-55,49-21-9-7-10-22-49)50-23-11-8-12-24-50)65(52-31-37-58(38-32-52)67(4,5)6)54-28-26-46-18-14-16-20-48(46)42-54/h7-44H,1-6H3 |
| InChIKey | UQTIKVBVDCYYON-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.33 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|