C65H66N2Si2 — CID 140717796
7,7-diphenyl-5-N,9-N-bis(4-propan-2-ylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine (PubChem CID 140717796) has the molecular formula C65H66N2Si2 and a molecular weight of 931.43 g/mol. Its IUPAC name is 7,7-diphenyl-5-N,9-N-bis(4-propan-2-ylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine.
| Compound Name | 7,7-diphenyl-5-N,9-N-bis(4-propan-2-ylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine |
|---|---|
| PubChem CID | 140717796 |
| Molecular Formula | C65H66N2Si2 |
| Molecular Weight | 931.43 g/mol |
| Exact Mass | 930.48 |
| IUPAC Name | 7,7-diphenyl-5-N,9-N-bis(4-propan-2-ylphenyl)-5-N,9-N-bis(4-trimethylsilylphenyl)benzo[c]fluorene-5,9-diamine |
| SMILES | CC(C)c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(N(c4ccc(C(C)C)cc4)c4ccc([Si](C)(C)C)cc4)c4ccccc4c2-3)cc1 |
| InChI | InChI=1S/C65H66N2Si2/c1-45(2)47-25-29-51(30-26-47)66(52-33-38-56(39-34-52)68(5,6)7)55-37-42-60-61(43-55)65(49-19-13-11-14-20-49,50-21-15-12-16-22-50)62-44-63(58-23-17-18-24-59(58)64(60)62)67(53-31-27-48(28-32-53)46(3)4)54-35-40-57(41-36-54)69(8,9)10/h11-46H,1-10H3 |
| InChIKey | MGEOXLKMIXIVJW-UHFFFAOYSA-N |
| XLogP | 17.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.43 |
| LogP ≤ 5 | 17.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|