C69H70N2OSi2 — CID 140775776
5-N,9-N-bis(4-tert-butylphenyl)-7,7-diphenyl-5-N,9-N-bis(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine (PubChem CID 140775776) has the molecular formula C69H70N2OSi2 and a molecular weight of 999.50 g/mol. Its IUPAC name is 5-N,9-N-bis(4-tert-butylphenyl)-7,7-diphenyl-5-N,9-N-bis(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine.
| Compound Name | 5-N,9-N-bis(4-tert-butylphenyl)-7,7-diphenyl-5-N,9-N-bis(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine |
|---|---|
| PubChem CID | 140775776 |
| Molecular Formula | C69H70N2OSi2 |
| Molecular Weight | 999.50 g/mol |
| Exact Mass | 998.50 |
| IUPAC Name | 5-N,9-N-bis(4-tert-butylphenyl)-7,7-diphenyl-5-N,9-N-bis(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5,9-diamine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2cc(N(c4ccc(C(C)(C)C)cc4)c4ccc([Si](C)(C)C)cc4)c4c(oc5ccccc54)c2-3)cc1 |
| InChI | InChI=1S/C69H70N2OSi2/c1-67(2,3)47-27-31-51(32-28-47)70(52-35-40-56(41-36-52)73(7,8)9)55-39-44-58-60(45-55)69(49-21-15-13-16-22-49,50-23-17-14-18-24-50)61-46-62(65-59-25-19-20-26-63(59)72-66(65)64(58)61)71(53-33-29-48(30-34-53)68(4,5)6)54-37-42-57(43-38-54)74(10,11)12/h13-46H,1-12H3 |
| InChIKey | WPOGLSVSYKEJBP-UHFFFAOYSA-N |
| XLogP | 18.57 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.50 |
| LogP ≤ 5 | 18.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|