C52H49NOSi — CID 140786782
N-(4-tert-butylphenyl)-7,7-bis(4-methylphenyl)-N-(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5-amine (PubChem CID 140786782) has the molecular formula C52H49NOSi and a molecular weight of 732.06 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-7,7-bis(4-methylphenyl)-N-(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5-amine.
| Compound Name | N-(4-tert-butylphenyl)-7,7-bis(4-methylphenyl)-N-(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5-amine |
|---|---|
| PubChem CID | 140786782 |
| Molecular Formula | C52H49NOSi |
| Molecular Weight | 732.06 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | N-(4-tert-butylphenyl)-7,7-bis(4-methylphenyl)-N-(4-trimethylsilylphenyl)fluoreno[4,3-b][1]benzofuran-5-amine |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)c3ccccc3-c3c2cc(N(c2ccc(C(C)(C)C)cc2)c2ccc([Si](C)(C)C)cc2)c2c3oc3ccccc32)cc1 |
| InChI | InChI=1S/C52H49NOSi/c1-34-17-21-37(22-18-34)52(38-23-19-35(2)20-24-38)44-15-11-9-13-42(44)48-45(52)33-46(49-43-14-10-12-16-47(43)54-50(48)49)53(39-27-25-36(26-28-39)51(3,4)5)40-29-31-41(32-30-40)55(6,7)8/h9-33H,1-8H3 |
| InChIKey | HBJINQMPPNLKJQ-UHFFFAOYSA-N |
| XLogP | 13.88 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.06 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|