C40H41NOSi — CID 140786774
N-(4-tert-butylphenyl)-14,14-dimethyl-N-(4-trimethylsilylphenyl)-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-amine (PubChem CID 140786774) has the molecular formula C40H41NOSi and a molecular weight of 579.86 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-14,14-dimethyl-N-(4-trimethylsilylphenyl)-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-amine.
| Compound Name | N-(4-tert-butylphenyl)-14,14-dimethyl-N-(4-trimethylsilylphenyl)-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-amine |
|---|---|
| PubChem CID | 140786774 |
| Molecular Formula | C40H41NOSi |
| Molecular Weight | 579.86 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | N-(4-tert-butylphenyl)-14,14-dimethyl-N-(4-trimethylsilylphenyl)-9-oxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1,3,5,7,10,12,15,17,19-nonaen-11-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc([Si](C)(C)C)cc2)c2cc3c(c4c2oc2ccccc24)-c2ccccc2C3(C)C)cc1 |
| InChI | InChI=1S/C40H41NOSi/c1-39(2,3)26-17-19-27(20-18-26)41(28-21-23-29(24-22-28)43(6,7)8)34-25-33-36(30-13-9-11-15-32(30)40(33,4)5)37-31-14-10-12-16-35(31)42-38(34)37/h9-25H,1-8H3 |
| InChIKey | WHYLNMHSKCYLGV-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.86 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|