About 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine
1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine (PubChem CID 123205452) has the molecular formula C10H25N3S
and a molecular weight of 219.40 g/mol. Its IUPAC name is 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine.
Molecular Properties
| Compound Name | 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine |
| PubChem CID | 123205452 |
| Molecular Formula | C10H25N3S |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine |
| SMILES | CCC(CC)N(C)C(N)=NS(C)(C)C |
| InChI | InChI=1S/C10H25N3S/c1-7-9(8-2)13(3)10(11)12-14(4,5)6/h9H,7-8H2,1-6H3,(H2,11,12) |
| InChIKey | OLWKNMVZHOZJTI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine?
The IUPAC name of 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine (CID 123205452) is 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine.
What is the SMILES notation for 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine?
The canonical SMILES for 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine is CCC(CC)N(C)C(N)=NS(C)(C)C.
What is the InChIKey of 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine?
The InChIKey is OLWKNMVZHOZJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25N3S/c1-7-9(8-2)13(3)10(11)12-14(4,5)6/h9H,7-8H2,1-6H3,(H2,11,12).
What are the key properties of 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine?
1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine has a molecular weight of 219.40 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-pentan-3-yl-2-(trimethyl-λ4-sulfanyl)guanidine is sourced from PubChem (CID 123205452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).