C17H30N2 — CID 123206074
N-ethyl-3-hexa-1,4,5-trienyliminononan-1-amine (PubChem CID 123206074) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-ethyl-3-hexa-1,4,5-trienyliminononan-1-amine.
| Compound Name | N-ethyl-3-hexa-1,4,5-trienyliminononan-1-amine |
|---|---|
| PubChem CID | 123206074 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-ethyl-3-hexa-1,4,5-trienyliminononan-1-amine |
| SMILES | C=C=CCC=C/N=C(\CCCCCC)CCNCC |
| InChI | InChI=1S/C17H30N2/c1-4-7-9-11-13-17(14-16-18-6-3)19-15-12-10-8-5-2/h8,12,15,18H,2,4,6-7,9-11,13-14,16H2,1,3H3/b15-12?,19-17+ |
| InChIKey | NMVMZSWZBYSXRK-FKVQFVJASA-N |
| XLogP | 4.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|