C45H83N — CID 139380837
(15Z,18Z)-N-ethyl-4-methylidene-6-[(9Z,12Z)-octadeca-9,12-dienyl]tetracosa-15,18-dien-1-amine (PubChem CID 139380837) has the molecular formula C45H83N and a molecular weight of 638.17 g/mol. Its IUPAC name is (15Z,18Z)-N-ethyl-4-methylidene-6-[(9Z,12Z)-octadeca-9,12-dienyl]tetracosa-15,18-dien-1-amine.
| Compound Name | (15Z,18Z)-N-ethyl-4-methylidene-6-[(9Z,12Z)-octadeca-9,12-dienyl]tetracosa-15,18-dien-1-amine |
|---|---|
| PubChem CID | 139380837 |
| Molecular Formula | C45H83N |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 637.65 |
| IUPAC Name | (15Z,18Z)-N-ethyl-4-methylidene-6-[(9Z,12Z)-octadeca-9,12-dienyl]tetracosa-15,18-dien-1-amine |
| SMILES | C=C(CCCNCC)CC(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C45H83N/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-45(43-44(4)39-38-42-46-7-3)41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h14-17,20-23,45-46H,4-13,18-19,24-43H2,1-3H3/b16-14-,17-15-,22-20-,23-21- |
| InChIKey | GGMJKUFUUXUYST-ZPPAUJSGSA-N |
| XLogP | 15.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 15.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|