About 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene
5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene (PubChem CID 166117737) has the molecular formula C27H53N
and a molecular weight of 391.73 g/mol. Its IUPAC name is 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene.
Molecular Properties
| Compound Name | 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene |
| PubChem CID | 166117737 |
| Molecular Formula | C27H53N |
| Molecular Weight | 391.73 g/mol |
| Exact Mass | 391.42 |
| IUPAC Name | 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene |
| SMILES | C=C(CCNCCC/C=C\CCCCCC)CC(CC)CCCCC.C=CC |
| InChI | InChI=1S/C24H47N.C3H6/c1-5-8-10-11-12-13-14-15-17-20-25-21-19-23(4)22-24(7-3)18-16-9-6-2;1-3-2/h13-14,24-25H,4-12,15-22H2,1-3H3;3H,1H2,2H3/b14-13-; |
| InChIKey | OCYHAZMFLZCPQK-HPWRNOGASA-N |
| XLogP | 9.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.73 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene?
The IUPAC name of 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene (CID 166117737) is 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene.
What is the SMILES notation for 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene?
The canonical SMILES for 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene is C=C(CCNCCC/C=C\CCCCCC)CC(CC)CCCCC.C=CC.
What is the InChIKey of 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene?
The InChIKey is OCYHAZMFLZCPQK-HPWRNOGASA-N. The full InChI is InChI=1S/C24H47N.C3H6/c1-5-8-10-11-12-13-14-15-17-20-25-21-19-23(4)22-24(7-3)18-16-9-6-2;1-3-2/h13-14,24-25H,4-12,15-22H2,1-3H3;3H,1H2,2H3/b14-13-;.
What are the key properties of 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene?
5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene has a molecular weight of 391.73 g/mol, XLogP of 9.02, 19 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-methylidene-N-[(Z)-undec-4-enyl]decan-1-amine;prop-1-ene is sourced from PubChem (CID 166117737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).