C15H20N2 — CID 123206998
(3Z,6Z,8Z,11Z)-2-N-ethyl-1-N-methylcyclododeca-3,6,8,11-tetraene-1,2-diimine (PubChem CID 123206998) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (3Z,6Z,8Z,11Z)-2-N-ethyl-1-N-methylcyclododeca-3,6,8,11-tetraene-1,2-diimine.
| Compound Name | (3Z,6Z,8Z,11Z)-2-N-ethyl-1-N-methylcyclododeca-3,6,8,11-tetraene-1,2-diimine |
|---|---|
| PubChem CID | 123206998 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (3Z,6Z,8Z,11Z)-2-N-ethyl-1-N-methylcyclododeca-3,6,8,11-tetraene-1,2-diimine |
| SMILES | CC/N=C1/C=C\C/C=C\C=C/C/C=C\C1=N/C |
| InChI | InChI=1S/C15H20N2/c1-3-17-15-13-11-9-7-5-4-6-8-10-12-14(15)16-2/h4-7,10-13H,3,8-9H2,1-2H3/b6-4-,7-5-,12-10-,13-11-,16-14+,17-15- |
| InChIKey | XZFCTEPKBDMPDG-KKDCBNTISA-N |
| XLogP | 3.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|