C15H25NO3 — CID 123207260
2-cyclohex-3-en-1-ylpropan-2-yl 4-hydroxypiperidine-1-carboxylate (PubChem CID 123207260) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-ylpropan-2-yl 4-hydroxypiperidine-1-carboxylate.
| Compound Name | 2-cyclohex-3-en-1-ylpropan-2-yl 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 123207260 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-cyclohex-3-en-1-ylpropan-2-yl 4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(OC(=O)N1CCC(O)CC1)C1CC=CCC1 |
| InChI | InChI=1S/C15H25NO3/c1-15(2,12-6-4-3-5-7-12)19-14(18)16-10-8-13(17)9-11-16/h3-4,12-13,17H,5-11H2,1-2H3 |
| InChIKey | NDKZQCHPJVWVIX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|