C18H14N2O6S2 — CID 123209285
5-[(4-methylsulfonylphenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 123209285) has the molecular formula C18H14N2O6S2 and a molecular weight of 418.45 g/mol. Its IUPAC name is 5-[(4-methylsulfonylphenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-methylsulfonylphenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123209285 |
| Molecular Formula | C18H14N2O6S2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 5-[(4-methylsulfonylphenyl)methylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(C=C2SC(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O6S2/c1-28(25,26)15-8-4-12(5-9-15)10-16-17(21)19(18(22)27-16)11-13-2-6-14(7-3-13)20(23)24/h2-10H,11H2,1H3 |
| InChIKey | OGOFIWRUHXAOSJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|