C16H14N2O3S — CID 2839872
3-benzyl-2-(4-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 2839872) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-benzyl-2-(4-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2839872 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 3-benzyl-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc([N+](=O)[O-])cc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H14N2O3S/c19-15-11-22-16(13-6-8-14(9-7-13)18(20)21)17(15)10-12-4-2-1-3-5-12/h1-9,16H,10-11H2 |
| InChIKey | WJURWESBBCDFET-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|