C9H10N2O2S — CID 2771066
2-(4-nitrophenyl)-1,3-thiazolidine (PubChem CID 2771066) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1,3-thiazolidine.
| Compound Name | 2-(4-nitrophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 2771066 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-(4-nitrophenyl)-1,3-thiazolidine |
| SMILES | O=[N+]([O-])c1ccc(C2NCCS2)cc1 |
| InChI | InChI=1S/C9H10N2O2S/c12-11(13)8-3-1-7(2-4-8)9-10-5-6-14-9/h1-4,9-10H,5-6H2 |
| InChIKey | FMRGPMCASSSEHQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|