C13H16N2O2S2 — CID 46877453
N,N-diethyl-4-(4-nitrophenyl)-1,3-dithiol-2-amine (PubChem CID 46877453) has the molecular formula C13H16N2O2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is N,N-diethyl-4-(4-nitrophenyl)-1,3-dithiol-2-amine.
| Compound Name | N,N-diethyl-4-(4-nitrophenyl)-1,3-dithiol-2-amine |
|---|---|
| PubChem CID | 46877453 |
| Molecular Formula | C13H16N2O2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N,N-diethyl-4-(4-nitrophenyl)-1,3-dithiol-2-amine |
| SMILES | CCN(CC)C1SC=C(c2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C13H16N2O2S2/c1-3-14(4-2)13-18-9-12(19-13)10-5-7-11(8-6-10)15(16)17/h5-9,13H,3-4H2,1-2H3 |
| InChIKey | LUYVNJCOXHAMAL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|